About 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate
2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate (PubChem CID 68798727) has the molecular formula C24H28N2O3
and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate |
| PubChem CID | 68798727 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate |
| SMILES | CCN(CC)CCOC(=O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H28N2O3/c1-3-26(4-2)17-18-28-22(27)16-15-21-25-23(19-11-7-5-8-12-19)24(29-21)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | HXPFPKNNGOHLTK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate?
The IUPAC name of 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate (CID 68798727) is 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate?
The canonical SMILES for 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate is CCN(CC)CCOC(=O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1.
What is the InChIKey of 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate?
The InChIKey is HXPFPKNNGOHLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O3/c1-3-26(4-2)17-18-28-22(27)16-15-21-25-23(19-11-7-5-8-12-19)24(29-21)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate?
2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate has a molecular weight of 392.50 g/mol, XLogP of 4.83, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoate is sourced from PubChem (CID 68798727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).