About 1H-cyclopenta[c]pyran-5,7-dione
1H-cyclopenta[c]pyran-5,7-dione (PubChem CID 68799013) has the molecular formula C8H6O3
and a molecular weight of 150.13 g/mol. Its IUPAC name is 1H-cyclopenta[c]pyran-5,7-dione.
Molecular Properties
| Compound Name | 1H-cyclopenta[c]pyran-5,7-dione |
| PubChem CID | 68799013 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1H-cyclopenta[c]pyran-5,7-dione |
| SMILES | O=C1CC(=O)C2=C1C=COC2 |
| InChI | InChI=1S/C8H6O3/c9-7-3-8(10)6-4-11-2-1-5(6)7/h1-2H,3-4H2 |
| InChIKey | BHVSMCNNRPYRGN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1H-cyclopenta[c]pyran-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclopenta[c]pyran-5,7-dione?
The IUPAC name of 1H-cyclopenta[c]pyran-5,7-dione (CID 68799013) is 1H-cyclopenta[c]pyran-5,7-dione.
What is the SMILES notation for 1H-cyclopenta[c]pyran-5,7-dione?
The canonical SMILES for 1H-cyclopenta[c]pyran-5,7-dione is O=C1CC(=O)C2=C1C=COC2.
What is the InChIKey of 1H-cyclopenta[c]pyran-5,7-dione?
The InChIKey is BHVSMCNNRPYRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3/c9-7-3-8(10)6-4-11-2-1-5(6)7/h1-2H,3-4H2.
What are the key properties of 1H-cyclopenta[c]pyran-5,7-dione?
1H-cyclopenta[c]pyran-5,7-dione has a molecular weight of 150.13 g/mol, XLogP of 0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclopenta[c]pyran-5,7-dione is sourced from PubChem (CID 68799013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).