C14H8BrN5O5S2 — CID 68799443
6-bromo-5-[5-(4-nitrophenyl)furan-2-yl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide (PubChem CID 68799443) has the molecular formula C14H8BrN5O5S2 and a molecular weight of 470.29 g/mol. Its IUPAC name is 6-bromo-5-[5-(4-nitrophenyl)furan-2-yl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide.
| Compound Name | 6-bromo-5-[5-(4-nitrophenyl)furan-2-yl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 68799443 |
| Molecular Formula | C14H8BrN5O5S2 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 468.92 |
| IUPAC Name | 6-bromo-5-[5-(4-nitrophenyl)furan-2-yl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nn2c(-c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)c(Br)nc2s1 |
| InChI | InChI=1S/C14H8BrN5O5S2/c15-12-11(19-13(17-12)26-14(18-19)27(16,23)24)10-6-5-9(25-10)7-1-3-8(4-2-7)20(21)22/h1-6H,(H2,16,23,24) |
| InChIKey | PAAAOSWJOHSYDJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|