C23H21N7O3 — CID 6880012
(E)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine (PubChem CID 6880012) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is (E)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine.
| Compound Name | (E)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 6880012 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (E)-N-[(10-benzyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/OCc2nc3c4cnn(Cc5ccccc5)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C23H21N7O3/c1-31-19-9-8-17(10-20(19)32-2)11-26-33-14-21-27-23-18-12-25-29(13-16-6-4-3-5-7-16)22(18)24-15-30(23)28-21/h3-12,15H,13-14H2,1-2H3/b26-11+ |
| InChIKey | DIJNGWLRCYMNLS-KBKYJPHKSA-N |
| XLogP | 3.09 |
| TPSA | 100.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|