About 5-butyl-5-ethyltetrazole
5-butyl-5-ethyltetrazole (PubChem CID 68800278) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 5-butyl-5-ethyltetrazole.
Molecular Properties
| Compound Name | 5-butyl-5-ethyltetrazole |
| PubChem CID | 68800278 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 5-butyl-5-ethyltetrazole |
| SMILES | CCCCC1(CC)N=NN=N1 |
| InChI | InChI=1S/C7H14N4/c1-3-5-6-7(4-2)8-10-11-9-7/h3-6H2,1-2H3 |
| InChIKey | RZCJGNVFLAOOAK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-5-ethyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-5-ethyltetrazole?
The IUPAC name of 5-butyl-5-ethyltetrazole (CID 68800278) is 5-butyl-5-ethyltetrazole.
What is the SMILES notation for 5-butyl-5-ethyltetrazole?
The canonical SMILES for 5-butyl-5-ethyltetrazole is CCCCC1(CC)N=NN=N1.
What is the InChIKey of 5-butyl-5-ethyltetrazole?
The InChIKey is RZCJGNVFLAOOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-3-5-6-7(4-2)8-10-11-9-7/h3-6H2,1-2H3.
What are the key properties of 5-butyl-5-ethyltetrazole?
5-butyl-5-ethyltetrazole has a molecular weight of 154.22 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-5-ethyltetrazole is sourced from PubChem (CID 68800278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).