C10H14F3N3O4 — CID 68800454
1-piperidin-4-ylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 68800454) has the molecular formula C10H14F3N3O4 and a molecular weight of 297.23 g/mol. Its IUPAC name is 1-piperidin-4-ylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-piperidin-4-ylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68800454 |
| Molecular Formula | C10H14F3N3O4 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-piperidin-4-ylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CN(C2CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C8H13N3O2.C2HF3O2/c12-7-5-11(8(13)10-7)6-1-3-9-4-2-6;3-2(4,5)1(6)7/h6,9H,1-5H2,(H,10,12,13);(H,6,7) |
| InChIKey | MMTCONQXXYOHCC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|