C19H16N2O4 — CID 68800487
13-(3-methylbutan-2-yl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone (PubChem CID 68800487) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 13-(3-methylbutan-2-yl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone.
| Compound Name | 13-(3-methylbutan-2-yl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 68800487 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 13-(3-methylbutan-2-yl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
| SMILES | CC(C)C(C)c1cc2c(=O)[nH]c(=O)c1c1c3ccc(c(=O)[nH]c3=O)c21 |
| InChI | InChI=1S/C19H16N2O4/c1-7(2)8(3)11-6-12-13-9-4-5-10(17(23)20-16(9)22)14(13)15(11)19(25)21-18(12)24/h4-8H,1-3H3,(H,20,22,23)(H,21,24,25) |
| InChIKey | DDRWSSHNQJIKDU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |