About 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole
2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole (PubChem CID 68800644) has the molecular formula C42H41FN2
and a molecular weight of 592.80 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole |
| PubChem CID | 68800644 |
| Molecular Formula | C42H41FN2 |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole |
| SMILES | CC(C)c1ccc(-c2cc(-c3ccc(C(C)C)cc3)c(-n3ccnc3-c3ccc(F)cc3)c(-c3ccc(C(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C42H41FN2/c1-27(2)30-7-13-33(14-8-30)37-25-39(34-15-9-31(10-16-34)28(3)4)41(40(26-37)35-17-11-32(12-18-35)29(5)6)45-24-23-44-42(45)36-19-21-38(43)22-20-36/h7-29H,1-6H3 |
| InChIKey | MPZKYZFFADHYEN-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole?
The IUPAC name of 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole (CID 68800644) is 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole.
What is the SMILES notation for 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole?
The canonical SMILES for 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole is CC(C)c1ccc(-c2cc(-c3ccc(C(C)C)cc3)c(-n3ccnc3-c3ccc(F)cc3)c(-c3ccc(C(C)C)cc3)c2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole?
The InChIKey is MPZKYZFFADHYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H41FN2/c1-27(2)30-7-13-33(14-8-30)37-25-39(34-15-9-31(10-16-34)28(3)4)41(40(26-37)35-17-11-32(12-18-35)29(5)6)45-24-23-44-42(45)36-19-21-38(43)22-20-36/h7-29H,1-6H3.
What are the key properties of 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole?
2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole has a molecular weight of 592.80 g/mol, XLogP of 12.05, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1-[2,4,6-tris(4-propan-2-ylphenyl)phenyl]imidazole is sourced from PubChem (CID 68800644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).