C31H28ClFN4O3 — CID 68800735
6-[[2-(3-chloro-4-cyanophenyl)-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carbonyl]amino]hexanoic acid (PubChem CID 68800735) has the molecular formula C31H28ClFN4O3 and a molecular weight of 559.04 g/mol. Its IUPAC name is 6-[[2-(3-chloro-4-cyanophenyl)-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(3-chloro-4-cyanophenyl)-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 68800735 |
| Molecular Formula | C31H28ClFN4O3 |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 6-[[2-(3-chloro-4-cyanophenyl)-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carbonyl]amino]hexanoic acid |
| SMILES | N#Cc1ccc(N2N=C3c4ccc(C(=O)NCCCCCC(=O)O)cc4CCC3C2c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C31H28ClFN4O3/c32-27-17-24(12-7-22(27)18-34)37-30(19-5-10-23(33)11-6-19)26-14-8-20-16-21(9-13-25(20)29(26)36-37)31(40)35-15-3-1-2-4-28(38)39/h5-7,9-13,16-17,26,30H,1-4,8,14-15H2,(H,35,40)(H,38,39) |
| InChIKey | CWLSDJQDRSFOHP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|