About [1-(aminomethyl)cyclohexyl] acetate;hydrochloride
[1-(aminomethyl)cyclohexyl] acetate;hydrochloride (PubChem CID 68801396) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is [1-(aminomethyl)cyclohexyl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [1-(aminomethyl)cyclohexyl] acetate;hydrochloride |
| PubChem CID | 68801396 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | [1-(aminomethyl)cyclohexyl] acetate;hydrochloride |
| SMILES | CC(=O)OC1(CN)CCCCC1.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-8(11)12-9(7-10)5-3-2-4-6-9;/h2-7,10H2,1H3;1H |
| InChIKey | SZQNPSGYOXDKGA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(aminomethyl)cyclohexyl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)cyclohexyl] acetate;hydrochloride?
The IUPAC name of [1-(aminomethyl)cyclohexyl] acetate;hydrochloride (CID 68801396) is [1-(aminomethyl)cyclohexyl] acetate;hydrochloride.
What is the SMILES notation for [1-(aminomethyl)cyclohexyl] acetate;hydrochloride?
The canonical SMILES for [1-(aminomethyl)cyclohexyl] acetate;hydrochloride is CC(=O)OC1(CN)CCCCC1.Cl.
What is the InChIKey of [1-(aminomethyl)cyclohexyl] acetate;hydrochloride?
The InChIKey is SZQNPSGYOXDKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c1-8(11)12-9(7-10)5-3-2-4-6-9;/h2-7,10H2,1H3;1H.
What are the key properties of [1-(aminomethyl)cyclohexyl] acetate;hydrochloride?
[1-(aminomethyl)cyclohexyl] acetate;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)cyclohexyl] acetate;hydrochloride is sourced from PubChem (CID 68801396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).