About [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride
[5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride (PubChem CID 68801817) has the molecular formula C6H11ClN2O2
and a molecular weight of 178.62 g/mol. Its IUPAC name is [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride |
| PubChem CID | 68801817 |
| Molecular Formula | C6H11ClN2O2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride |
| SMILES | Cc1nc(CO)oc1CN.Cl |
| InChI | InChI=1S/C6H10N2O2.ClH/c1-4-5(2-7)10-6(3-9)8-4;/h9H,2-3,7H2,1H3;1H |
| InChIKey | HRNIQSBUTJYSTM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride?
The IUPAC name of [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride (CID 68801817) is [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride.
What is the SMILES notation for [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride?
The canonical SMILES for [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride is Cc1nc(CO)oc1CN.Cl.
What is the InChIKey of [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride?
The InChIKey is HRNIQSBUTJYSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.ClH/c1-4-5(2-7)10-6(3-9)8-4;/h9H,2-3,7H2,1H3;1H.
What are the key properties of [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride?
[5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(aminomethyl)-4-methyl-1,3-oxazol-2-yl]methanol;hydrochloride is sourced from PubChem (CID 68801817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).