About hepta-1,6-dien-4-one;1H-pyrrole
hepta-1,6-dien-4-one;1H-pyrrole (PubChem CID 68802024) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is hepta-1,6-dien-4-one;1H-pyrrole.
Molecular Properties
| Compound Name | hepta-1,6-dien-4-one;1H-pyrrole |
| PubChem CID | 68802024 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | hepta-1,6-dien-4-one;1H-pyrrole |
| SMILES | C=CCC(=O)CC=C.c1cc[nH]c1 |
| InChI | InChI=1S/C7H10O.C4H5N/c1-3-5-7(8)6-4-2;1-2-4-5-3-1/h3-4H,1-2,5-6H2;1-5H |
| InChIKey | FPXKAVZGAGGULC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,6-dien-4-one;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,6-dien-4-one;1H-pyrrole?
The IUPAC name of hepta-1,6-dien-4-one;1H-pyrrole (CID 68802024) is hepta-1,6-dien-4-one;1H-pyrrole.
What is the SMILES notation for hepta-1,6-dien-4-one;1H-pyrrole?
The canonical SMILES for hepta-1,6-dien-4-one;1H-pyrrole is C=CCC(=O)CC=C.c1cc[nH]c1.
What is the InChIKey of hepta-1,6-dien-4-one;1H-pyrrole?
The InChIKey is FPXKAVZGAGGULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C4H5N/c1-3-5-7(8)6-4-2;1-2-4-5-3-1/h3-4H,1-2,5-6H2;1-5H.
What are the key properties of hepta-1,6-dien-4-one;1H-pyrrole?
hepta-1,6-dien-4-one;1H-pyrrole has a molecular weight of 177.25 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-4-one;1H-pyrrole is sourced from PubChem (CID 68802024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).