About 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide
3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 68802804) has the molecular formula C9H7ClN4O
and a molecular weight of 222.64 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 68802804 |
| Molecular Formula | C9H7ClN4O |
| Molecular Weight | 222.64 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C9H7ClN4O/c10-6-3-1-5(2-4-6)8-12-9(7(11)15)14-13-8/h1-4H,(H2,11,15)(H,12,13,14) |
| InChIKey | JUOYWDZDKALSJL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide (CID 68802804) is 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide is NC(=O)c1nc(-c2ccc(Cl)cc2)n[nH]1.
What is the InChIKey of 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is JUOYWDZDKALSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN4O/c10-6-3-1-5(2-4-6)8-12-9(7(11)15)14-13-8/h1-4H,(H2,11,15)(H,12,13,14).
What are the key properties of 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide?
3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 222.64 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 68802804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).