C31H57NO3 — CID 68803193
2-ethylhexyl 1-[(Z)-octadec-9-enyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 68803193) has the molecular formula C31H57NO3 and a molecular weight of 491.80 g/mol. Its IUPAC name is 2-ethylhexyl 1-[(Z)-octadec-9-enyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 2-ethylhexyl 1-[(Z)-octadec-9-enyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 68803193 |
| Molecular Formula | C31H57NO3 |
| Molecular Weight | 491.80 g/mol |
| Exact Mass | 491.43 |
| IUPAC Name | 2-ethylhexyl 1-[(Z)-octadec-9-enyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN1CC(C(=O)OCC(CC)CCCC)CC1=O |
| InChI | InChI=1S/C31H57NO3/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-32-26-29(25-30(32)33)31(34)35-27-28(6-3)23-8-5-2/h14-15,28-29H,4-13,16-27H2,1-3H3/b15-14- |
| InChIKey | COXGIVWNYAIYOE-PFONDFGASA-N |
| XLogP | 8.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.80 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|