About 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one
4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one (PubChem CID 68803223) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one |
| PubChem CID | 68803223 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one |
| SMILES | CCN1CC(C2=NCCO2)CC1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-11-6-7(5-8(11)12)9-10-3-4-13-9/h7H,2-6H2,1H3 |
| InChIKey | BFBJZJMXWPYNRU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one?
The IUPAC name of 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one (CID 68803223) is 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one.
What is the SMILES notation for 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one?
The canonical SMILES for 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one is CCN1CC(C2=NCCO2)CC1=O.
What is the InChIKey of 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one?
The InChIKey is BFBJZJMXWPYNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-11-6-7(5-8(11)12)9-10-3-4-13-9/h7H,2-6H2,1H3.
What are the key properties of 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one?
4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one has a molecular weight of 182.22 g/mol, XLogP of 0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1,3-oxazol-2-yl)-1-ethylpyrrolidin-2-one is sourced from PubChem (CID 68803223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).