About 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride
4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride (PubChem CID 68803440) has the molecular formula C7H8ClN3O2S
and a molecular weight of 233.68 g/mol. Its IUPAC name is 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride |
| PubChem CID | 68803440 |
| Molecular Formula | C7H8ClN3O2S |
| Molecular Weight | 233.68 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)C1=NC=C2N=CC=C2C1 |
| InChI | InChI=1S/C7H7N3O2S.ClH/c8-13(11,12)7-3-5-1-2-9-6(5)4-10-7;/h1-2,4H,3H2,(H2,8,11,12);1H |
| InChIKey | UNONNWSNJZLUEL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride?
The IUPAC name of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride (CID 68803440) is 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride.
What is the SMILES notation for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride?
The canonical SMILES for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride is Cl.NS(=O)(=O)C1=NC=C2N=CC=C2C1.
What is the InChIKey of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride?
The InChIKey is UNONNWSNJZLUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S.ClH/c8-13(11,12)7-3-5-1-2-9-6(5)4-10-7;/h1-2,4H,3H2,(H2,8,11,12);1H.
What are the key properties of 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride?
4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride has a molecular weight of 233.68 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[2,3-c]pyridine-5-sulfonamide;hydrochloride is sourced from PubChem (CID 68803440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).