C13H18N2O — CID 68803474
8-methoxy-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline (PubChem CID 68803474) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-methoxy-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline.
| Compound Name | 8-methoxy-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 68803474 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 8-methoxy-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
| SMILES | COc1ccc2c(c1)CCC1CNCCN21 |
| InChI | InChI=1S/C13H18N2O/c1-16-12-4-5-13-10(8-12)2-3-11-9-14-6-7-15(11)13/h4-5,8,11,14H,2-3,6-7,9H2,1H3 |
| InChIKey | TYHGDKRDHDPVOC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|