About 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride
1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride (PubChem CID 68803776) has the molecular formula C7H7ClN2S
and a molecular weight of 186.67 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride.
Molecular Properties
| Compound Name | 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride |
| PubChem CID | 68803776 |
| Molecular Formula | C7H7ClN2S |
| Molecular Weight | 186.67 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride |
| SMILES | Cl.S=c1cc2cc[nH]c2c[nH]1 |
| InChI | InChI=1S/C7H6N2S.ClH/c10-7-3-5-1-2-8-6(5)4-9-7;/h1-4,8H,(H,9,10);1H |
| InChIKey | BJQRQRTWHSIRBA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride?
The IUPAC name of 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride (CID 68803776) is 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride.
What is the SMILES notation for 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride?
The canonical SMILES for 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride is Cl.S=c1cc2cc[nH]c2c[nH]1.
What is the InChIKey of 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride?
The InChIKey is BJQRQRTWHSIRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S.ClH/c10-7-3-5-1-2-8-6(5)4-9-7;/h1-4,8H,(H,9,10);1H.
What are the key properties of 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride?
1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride has a molecular weight of 186.67 g/mol, XLogP of 2.65, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrrolo[2,3-c]pyridine-5-thione;hydrochloride is sourced from PubChem (CID 68803776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).