C14H17F4N3O — CID 68804008
1,1,5-trifluoro-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol (PubChem CID 68804008) has the molecular formula C14H17F4N3O and a molecular weight of 319.30 g/mol. Its IUPAC name is 1,1,5-trifluoro-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol.
| Compound Name | 1,1,5-trifluoro-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 68804008 |
| Molecular Formula | C14H17F4N3O |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1,1,5-trifluoro-2-[(7-fluoro-1H-pyrrolo[2,3-c]pyridin-2-yl)methylamino]-4-methylpentan-2-ol |
| SMILES | CC(CF)CC(O)(NCc1cc2ccnc(F)c2[nH]1)C(F)F |
| InChI | InChI=1S/C14H17F4N3O/c1-8(6-15)5-14(22,13(17)18)20-7-10-4-9-2-3-19-12(16)11(9)21-10/h2-4,8,13,20-22H,5-7H2,1H3 |
| InChIKey | VFUMLGXMWYTJJM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|