C25H29N3O4 — CID 68804193
but-2-enedioic acid;N-[5-(3-methylphenyl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine (PubChem CID 68804193) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is but-2-enedioic acid;N-[5-(3-methylphenyl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine.
| Compound Name | but-2-enedioic acid;N-[5-(3-methylphenyl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine |
|---|---|
| PubChem CID | 68804193 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | but-2-enedioic acid;N-[5-(3-methylphenyl)-3-pyridinyl]-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| SMILES | Cc1cccc(-c2cncc(NC3C4CC5CC3CN(C5)C4)c2)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H25N3.C4H4O4/c1-14-3-2-4-16(5-14)17-8-20(10-22-9-17)23-21-18-6-15-7-19(21)13-24(11-15)12-18;5-3(6)1-2-4(7)8/h2-5,8-10,15,18-19,21,23H,6-7,11-13H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | KILOHHKQZNMQHN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|