C9H9F2NO — CID 68804465
5,8-difluoro-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 68804465) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 5,8-difluoro-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | 5,8-difluoro-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 68804465 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5,8-difluoro-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | NC1COCc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C9H9F2NO/c10-6-1-2-7(11)9-5(6)3-13-4-8(9)12/h1-2,8H,3-4,12H2 |
| InChIKey | MGIWYIZHBUQBFU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |