About 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile
1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile (PubChem CID 68804667) has the molecular formula C9H4N4
and a molecular weight of 168.16 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile |
| PubChem CID | 68804667 |
| Molecular Formula | C9H4N4 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc2c(C#N)c[nH]c2cn1 |
| InChI | InChI=1S/C9H4N4/c10-2-6-4-13-9-5-12-7(3-11)1-8(6)9/h1,4-5,13H |
| InChIKey | YPKOIXBZBPCDQI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile?
The IUPAC name of 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile (CID 68804667) is 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile.
What is the SMILES notation for 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile?
The canonical SMILES for 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile is N#Cc1cc2c(C#N)c[nH]c2cn1.
What is the InChIKey of 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile?
The InChIKey is YPKOIXBZBPCDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N4/c10-2-6-4-13-9-5-12-7(3-11)1-8(6)9/h1,4-5,13H.
What are the key properties of 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile?
1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile has a molecular weight of 168.16 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-c]pyridine-3,5-dicarbonitrile is sourced from PubChem (CID 68804667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).