About tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide
tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide (PubChem CID 68804943) has the molecular formula C16H25IN2O3
and a molecular weight of 420.29 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide |
| PubChem CID | 68804943 |
| Molecular Formula | C16H25IN2O3 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide |
| SMILES | C[n+]1ccc(OC[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1.[I-] |
| InChI | InChI=1S/C16H25N2O3.HI/c1-16(2,3)21-15(19)18-9-5-6-13(18)12-20-14-7-10-17(4)11-8-14;/h7-8,10-11,13H,5-6,9,12H2,1-4H3;1H/q+1;/p-1/t13-;/m0./s1 |
| InChIKey | DRFCSQUZORCZSY-ZOWNYOTGSA-M |
| XLogP | -0.71 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide?
The IUPAC name of tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide (CID 68804943) is tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide.
What is the SMILES notation for tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide?
The canonical SMILES for tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide is C[n+]1ccc(OC[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1.[I-].
What is the InChIKey of tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide?
The InChIKey is DRFCSQUZORCZSY-ZOWNYOTGSA-M. The full InChI is InChI=1S/C16H25N2O3.HI/c1-16(2,3)21-15(19)18-9-5-6-13(18)12-20-14-7-10-17(4)11-8-14;/h7-8,10-11,13H,5-6,9,12H2,1-4H3;1H/q+1;/p-1/t13-;/m0./s1.
What are the key properties of tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide?
tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide has a molecular weight of 420.29 g/mol, XLogP of -0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(1-methylpyridin-1-ium-4-yl)oxymethyl]pyrrolidine-1-carboxylate iodide is sourced from PubChem (CID 68804943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).