About (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid
(2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 68805778) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 68805778 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CS[C@H](c2cncnc2)N1 |
| InChI | InChI=1S/C8H9N3O2S/c12-8(13)6-3-14-7(11-6)5-1-9-4-10-2-5/h1-2,4,6-7,11H,3H2,(H,12,13)/t6?,7-/m1/s1 |
| InChIKey | UYADJNHEMNONLB-COBSHVIPSA-N |
| XLogP | 0.26 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid (CID 68805778) is (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CS[C@H](c2cncnc2)N1.
What is the InChIKey of (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is UYADJNHEMNONLB-COBSHVIPSA-N. The full InChI is InChI=1S/C8H9N3O2S/c12-8(13)6-3-14-7(11-6)5-1-9-4-10-2-5/h1-2,4,6-7,11H,3H2,(H,12,13)/t6?,7-/m1/s1.
What are the key properties of (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid?
(2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 211.25 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-pyrimidin-5-yl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 68805778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).