About 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 68805837) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 68805837 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC1(N)CC=C(N2CCOCC2)C=C1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-11(16)3-2-9(8-10(11)12(13,14)15)17-4-6-18-7-5-17/h2,8H,3-7,16H2,1H3 |
| InChIKey | ZHPFMFSQCWYGSI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 68805837) is 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is CC1(N)CC=C(N2CCOCC2)C=C1C(F)(F)F.
What is the InChIKey of 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is ZHPFMFSQCWYGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O/c1-11(16)3-2-9(8-10(11)12(13,14)15)17-4-6-18-7-5-17/h2,8H,3-7,16H2,1H3.
What are the key properties of 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 262.27 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-morpholin-4-yl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 68805837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).