C18H19N4O4PS — CID 68805894
2-[(6-amino-3-pyridinyl)methyl]-3-[hydroxy-[[4-(thiadiazol-4-yl)phenyl]methyl]phosphoryl]propanoic acid (PubChem CID 68805894) has the molecular formula C18H19N4O4PS and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)methyl]-3-[hydroxy-[[4-(thiadiazol-4-yl)phenyl]methyl]phosphoryl]propanoic acid.
| Compound Name | 2-[(6-amino-3-pyridinyl)methyl]-3-[hydroxy-[[4-(thiadiazol-4-yl)phenyl]methyl]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 68805894 |
| Molecular Formula | C18H19N4O4PS |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)methyl]-3-[hydroxy-[[4-(thiadiazol-4-yl)phenyl]methyl]phosphoryl]propanoic acid |
| SMILES | Nc1ccc(CC(CP(=O)(O)Cc2ccc(-c3csnn3)cc2)C(=O)O)cn1 |
| InChI | InChI=1S/C18H19N4O4PS/c19-17-6-3-13(8-20-17)7-15(18(23)24)10-27(25,26)9-12-1-4-14(5-2-12)16-11-28-22-21-16/h1-6,8,11,15H,7,9-10H2,(H2,19,20)(H,23,24)(H,25,26) |
| InChIKey | FMJMSDGBVRSXLS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|