methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate

C9H8N2O2 — CID 68806043

IUPACmethyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate
SMILESCOC(=O)C1=NC=C2N=CC=C2C1
InChIInChI=1S/C9H8N2O2/c1-13-9(12)7-4-6-2-3-10-8(6)5-11-7/h2-3,5H,4H2,1H3
InChIKeyUGZOVXYJBPQHDZ-UHFFFAOYSA-N
MW176.17 g/mol
LogP0.86
Rot. Bonds1

About methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate

methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate (PubChem CID 68806043) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate.

Molecular Properties

Compound Namemethyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate
PubChem CID68806043
Molecular FormulaC9H8N2O2
Molecular Weight176.17 g/mol
Exact Mass176.06
IUPAC Namemethyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate
SMILESCOC(=O)C1=NC=C2N=CC=C2C1
InChIInChI=1S/C9H8N2O2/c1-13-9(12)7-4-6-2-3-10-8(6)5-11-7/h2-3,5H,4H2,1H3
InChIKeyUGZOVXYJBPQHDZ-UHFFFAOYSA-N
XLogP0.86
TPSA51.02 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 50.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate?
The IUPAC name of methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate (CID 68806043) is methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate.
What is the SMILES notation for methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate?
The canonical SMILES for methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate is COC(=O)C1=NC=C2N=CC=C2C1.
What is the InChIKey of methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate?
The InChIKey is UGZOVXYJBPQHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-13-9(12)7-4-6-2-3-10-8(6)5-11-7/h2-3,5H,4H2,1H3.
What are the key properties of methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate?
methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate has a molecular weight of 176.17 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-pyrrolo[2,3-c]pyridine-5-carboxylate is sourced from PubChem (CID 68806043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).