About (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid
(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 68806945) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 68806945 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CS[C@H](c2cnco2)N1 |
| InChI | InChI=1S/C7H8N2O3S/c10-7(11)4-2-13-6(9-4)5-1-8-3-12-5/h1,3-4,6,9H,2H2,(H,10,11)/t4?,6-/m1/s1 |
| InChIKey | HXHSLHJGAGGMQL-BAFYGKSASA-N |
| XLogP | 0.46 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid (CID 68806945) is (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CS[C@H](c2cnco2)N1.
What is the InChIKey of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is HXHSLHJGAGGMQL-BAFYGKSASA-N. The full InChI is InChI=1S/C7H8N2O3S/c10-7(11)4-2-13-6(9-4)5-1-8-3-12-5/h1,3-4,6,9H,2H2,(H,10,11)/t4?,6-/m1/s1.
What are the key properties of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 200.22 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 68806945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).