(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid

C7H8N2O3S — CID 68806945

IUPAC(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CS[C@H](c2cnco2)N1
InChIInChI=1S/C7H8N2O3S/c10-7(11)4-2-13-6(9-4)5-1-8-3-12-5/h1,3-4,6,9H,2H2,(H,10,11)/t4?,6-/m1/s1
InChIKeyHXHSLHJGAGGMQL-BAFYGKSASA-N
MW200.22 g/mol
LogP0.46
Rot. Bonds2

About (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid

(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 68806945) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid
PubChem CID68806945
Molecular FormulaC7H8N2O3S
Molecular Weight200.22 g/mol
Exact Mass200.03
IUPAC Name(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CS[C@H](c2cnco2)N1
InChIInChI=1S/C7H8N2O3S/c10-7(11)4-2-13-6(9-4)5-1-8-3-12-5/h1,3-4,6,9H,2H2,(H,10,11)/t4?,6-/m1/s1
InChIKeyHXHSLHJGAGGMQL-BAFYGKSASA-N
XLogP0.46
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.22
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid (CID 68806945) is (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CS[C@H](c2cnco2)N1.
What is the InChIKey of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is HXHSLHJGAGGMQL-BAFYGKSASA-N. The full InChI is InChI=1S/C7H8N2O3S/c10-7(11)4-2-13-6(9-4)5-1-8-3-12-5/h1,3-4,6,9H,2H2,(H,10,11)/t4?,6-/m1/s1.
What are the key properties of (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid?
(2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 200.22 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-oxazol-5-yl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 68806945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).