About 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide
4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 68809153) has the molecular formula C9H9N3O2S2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 68809153 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)c(-c2nccs2)c1 |
| InChI | InChI=1S/C9H9N3O2S2/c10-6-1-2-8(16(11,13)14)7(5-6)9-12-3-4-15-9/h1-5H,10H2,(H2,11,13,14) |
| InChIKey | UZGVPWSKIPSSGH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide (CID 68809153) is 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide is Nc1ccc(S(N)(=O)=O)c(-c2nccs2)c1.
What is the InChIKey of 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is UZGVPWSKIPSSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S2/c10-6-1-2-8(16(11,13)14)7(5-6)9-12-3-4-15-9/h1-5H,10H2,(H2,11,13,14).
What are the key properties of 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide?
4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 255.32 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 68809153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).