About 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one
5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one (PubChem CID 68809514) has the molecular formula C13H17IN2O
and a molecular weight of 344.20 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one |
| PubChem CID | 68809514 |
| Molecular Formula | C13H17IN2O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one |
| SMILES | CCN(CC)Cc1cc(I)c2c(c1)CNC2=O |
| InChI | InChI=1S/C13H17IN2O/c1-3-16(4-2)8-9-5-10-7-15-13(17)12(10)11(14)6-9/h5-6H,3-4,7-8H2,1-2H3,(H,15,17) |
| InChIKey | YXFUYXTZFJECQM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one (CID 68809514) is 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one is CCN(CC)Cc1cc(I)c2c(c1)CNC2=O.
What is the InChIKey of 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one?
The InChIKey is YXFUYXTZFJECQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IN2O/c1-3-16(4-2)8-9-5-10-7-15-13(17)12(10)11(14)6-9/h5-6H,3-4,7-8H2,1-2H3,(H,15,17).
What are the key properties of 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one?
5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one has a molecular weight of 344.20 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylaminomethyl)-7-iodo-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 68809514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).