C16H16N2O3 — CID 6880952
(2E)-2-benzylidene-N-[(E)-furan-2-ylmethylideneamino]-4-hydroxybutanamide (PubChem CID 6880952) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2E)-2-benzylidene-N-[(E)-furan-2-ylmethylideneamino]-4-hydroxybutanamide.
| Compound Name | (2E)-2-benzylidene-N-[(E)-furan-2-ylmethylideneamino]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 6880952 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2E)-2-benzylidene-N-[(E)-furan-2-ylmethylideneamino]-4-hydroxybutanamide |
| SMILES | O=C(N/N=C/c1ccco1)/C(=C/c1ccccc1)CCO |
| InChI | InChI=1S/C16H16N2O3/c19-9-8-14(11-13-5-2-1-3-6-13)16(20)18-17-12-15-7-4-10-21-15/h1-7,10-12,19H,8-9H2,(H,18,20)/b14-11+,17-12+ |
| InChIKey | RBOPTZZZGBZKQP-DMAJYYCCSA-N |
| XLogP | 2.20 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|