About 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride
7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride (PubChem CID 68809673) has the molecular formula C19H21ClN4O
and a molecular weight of 356.86 g/mol. Its IUPAC name is 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride.
Molecular Properties
| Compound Name | 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride |
| PubChem CID | 68809673 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride |
| SMILES | CN(C)Cc1cc2c(c(-c3cc4cc(N)ccc4[nH]3)c1)C(=O)NC2.Cl |
| InChI | InChI=1S/C19H20N4O.ClH/c1-23(2)10-11-5-13-9-21-19(24)18(13)15(6-11)17-8-12-7-14(20)3-4-16(12)22-17;/h3-8,22H,9-10,20H2,1-2H3,(H,21,24);1H |
| InChIKey | AUHIUNJLJNMQCH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride?
The IUPAC name of 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride (CID 68809673) is 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride.
What is the SMILES notation for 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride?
The canonical SMILES for 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride is CN(C)Cc1cc2c(c(-c3cc4cc(N)ccc4[nH]3)c1)C(=O)NC2.Cl.
What is the InChIKey of 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride?
The InChIKey is AUHIUNJLJNMQCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O.ClH/c1-23(2)10-11-5-13-9-21-19(24)18(13)15(6-11)17-8-12-7-14(20)3-4-16(12)22-17;/h3-8,22H,9-10,20H2,1-2H3,(H,21,24);1H.
What are the key properties of 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride?
7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride has a molecular weight of 356.86 g/mol, XLogP of 3.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-amino-1H-indol-2-yl)-5-[(dimethylamino)methyl]-2,3-dihydroisoindol-1-one;hydrochloride is sourced from PubChem (CID 68809673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).