C44H54O4 — CID 68810316
1-(1-adamantyl)-3,5-bis[2,4-bis(prop-2-enoxy)phenyl]adamantane (PubChem CID 68810316) has the molecular formula C44H54O4 and a molecular weight of 646.91 g/mol. Its IUPAC name is 1-(1-adamantyl)-3,5-bis[2,4-bis(prop-2-enoxy)phenyl]adamantane.
| Compound Name | 1-(1-adamantyl)-3,5-bis[2,4-bis(prop-2-enoxy)phenyl]adamantane |
|---|---|
| PubChem CID | 68810316 |
| Molecular Formula | C44H54O4 |
| Molecular Weight | 646.91 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | 1-(1-adamantyl)-3,5-bis[2,4-bis(prop-2-enoxy)phenyl]adamantane |
| SMILES | C=CCOc1ccc(C23CC4CC(c5ccc(OCC=C)cc5OCC=C)(C2)CC(C25CC6CC(CC(C6)C2)C5)(C4)C3)c(OCC=C)c1 |
| InChI | InChI=1S/C44H54O4/c1-5-13-45-35-9-11-37(39(20-35)47-15-7-3)41-22-34-23-42(28-41,38-12-10-36(46-14-6-2)21-40(38)48-16-8-4)30-44(27-34,29-41)43-24-31-17-32(25-43)19-33(18-31)26-43/h5-12,20-21,31-34H,1-4,13-19,22-30H2 |
| InChIKey | VDLOZWGWTGWBOD-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.91 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|