1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid

C8H12ClNO2 — CID 68810539

IUPAC1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid
SMILESO=C(O)C1=CCCN(CCCl)C1
InChIInChI=1S/C8H12ClNO2/c9-3-5-10-4-1-2-7(6-10)8(11)12/h2H,1,3-6H2,(H,11,12)
InChIKeyHUEHDVUVQRQRKX-UHFFFAOYSA-N
MW189.64 g/mol
LogP0.94
Rot. Bonds3

About 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid

1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid (PubChem CID 68810539) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid.

Molecular Properties

Compound Name1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid
PubChem CID68810539
Molecular FormulaC8H12ClNO2
Molecular Weight189.64 g/mol
Exact Mass189.06
IUPAC Name1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid
SMILESO=C(O)C1=CCCN(CCCl)C1
InChIInChI=1S/C8H12ClNO2/c9-3-5-10-4-1-2-7(6-10)8(11)12/h2H,1,3-6H2,(H,11,12)
InChIKeyHUEHDVUVQRQRKX-UHFFFAOYSA-N
XLogP0.94
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.64
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The IUPAC name of 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid (CID 68810539) is 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid.
What is the SMILES notation for 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The canonical SMILES for 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid is O=C(O)C1=CCCN(CCCl)C1.
What is the InChIKey of 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The InChIKey is HUEHDVUVQRQRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO2/c9-3-5-10-4-1-2-7(6-10)8(11)12/h2H,1,3-6H2,(H,11,12).
What are the key properties of 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid?
1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid has a molecular weight of 189.64 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid is sourced from PubChem (CID 68810539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).