C26H39FN2O5S — CID 68810570
(4S,7R,8S,9S,13Z,16S)-16-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-fluoroethenyl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 68810570) has the molecular formula C26H39FN2O5S and a molecular weight of 510.67 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-16-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-fluoroethenyl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-16-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-fluoroethenyl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 68810570 |
| Molecular Formula | C26H39FN2O5S |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-16-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-fluoroethenyl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](C(F)=Cc2csc(CN)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C26H39FN2O5S/c1-15-7-6-8-16(2)24(32)17(3)25(33)26(4,5)21(30)12-23(31)34-20(10-9-15)19(27)11-18-14-35-22(13-28)29-18/h9,11,14,16-17,20-21,24,30,32H,6-8,10,12-13,28H2,1-5H3/b15-9-,19-11?/t16-,17+,20-,21-,24-/m0/s1 |
| InChIKey | ZAKDNORFDZJHNF-ZDTZZOLRSA-N |
| XLogP | 4.32 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|