C23H22ClF3N6O2 — CID 68810977
N-[1-[2-[4-[(4-chlorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]pyrrolidin-1-yl]-2-nitroethenyl]-4-(trifluoromethyl)aniline (PubChem CID 68810977) has the molecular formula C23H22ClF3N6O2 and a molecular weight of 506.92 g/mol. Its IUPAC name is N-[1-[2-[4-[(4-chlorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]pyrrolidin-1-yl]-2-nitroethenyl]-4-(trifluoromethyl)aniline.
| Compound Name | N-[1-[2-[4-[(4-chlorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]pyrrolidin-1-yl]-2-nitroethenyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 68810977 |
| Molecular Formula | C23H22ClF3N6O2 |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | N-[1-[2-[4-[(4-chlorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]pyrrolidin-1-yl]-2-nitroethenyl]-4-(trifluoromethyl)aniline |
| SMILES | Cc1nnc(C2CCCN2C(=C[N+](=O)[O-])Nc2ccc(C(F)(F)F)cc2)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClF3N6O2/c1-15-29-30-22(32(15)13-16-4-8-18(24)9-5-16)20-3-2-12-31(20)21(14-33(34)35)28-19-10-6-17(7-11-19)23(25,26)27/h4-11,14,20,28H,2-3,12-13H2,1H3 |
| InChIKey | ZEDYQHWSURYPDJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|