C13H16O4 — CID 68811032
methyl 2-[(3R,4S)-3,4-dihydroxycyclopentyl]benzoate (PubChem CID 68811032) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-3,4-dihydroxycyclopentyl]benzoate.
| Compound Name | methyl 2-[(3R,4S)-3,4-dihydroxycyclopentyl]benzoate |
|---|---|
| PubChem CID | 68811032 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl 2-[(3R,4S)-3,4-dihydroxycyclopentyl]benzoate |
| SMILES | COC(=O)c1ccccc1C1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C13H16O4/c1-17-13(16)10-5-3-2-4-9(10)8-6-11(14)12(15)7-8/h2-5,8,11-12,14-15H,6-7H2,1H3/t8?,11-,12+ |
| InChIKey | RUCJLFDIEGJOIM-FOGGPMGISA-N |
| XLogP | 1.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |