About 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one
4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one (PubChem CID 68811246) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one |
| PubChem CID | 68811246 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one |
| SMILES | C=C(CCN(C)C)C(=O)O.C=CN1CCCC1=O |
| InChI | InChI=1S/C7H13NO2.C6H9NO/c1-6(7(9)10)4-5-8(2)3;1-2-7-5-3-4-6(7)8/h1,4-5H2,2-3H3,(H,9,10);2H,1,3-5H2 |
| InChIKey | XJCMIOJDIHJPGP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one?
The IUPAC name of 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one (CID 68811246) is 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one?
The canonical SMILES for 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one is C=C(CCN(C)C)C(=O)O.C=CN1CCCC1=O.
What is the InChIKey of 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one?
The InChIKey is XJCMIOJDIHJPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C6H9NO/c1-6(7(9)10)4-5-8(2)3;1-2-7-5-3-4-6(7)8/h1,4-5H2,2-3H3,(H,9,10);2H,1,3-5H2.
What are the key properties of 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one?
4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one has a molecular weight of 254.33 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2-methylidenebutanoic acid;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 68811246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).