C43H30FN5O3 — CID 68811845
N-(1,3-benzodioxol-5-yl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 68811845) has the molecular formula C43H30FN5O3 and a molecular weight of 683.74 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 68811845 |
| Molecular Formula | C43H30FN5O3 |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F |
| InChI | InChI=1S/C43H30FN5O3/c44-37-22-29(16-19-36(37)42(50)47-35-18-20-39-40(23-35)52-28-51-39)38-25-45-41-21-17-30(26-48(38)41)31-24-46-49(27-31)43(32-10-4-1-5-11-32,33-12-6-2-7-13-33)34-14-8-3-9-15-34/h1-27H,28H2,(H,47,50) |
| InChIKey | NDTCHFLDNHSXCC-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|