C30H41NO5S — CID 68812052
(4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 68812052) has the molecular formula C30H41NO5S and a molecular weight of 527.73 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 68812052 |
| Molecular Formula | C30H41NO5S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C=CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3sc(C)nc3c2)CC=C(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H41NO5S/c1-7-9-22-28(34)19(3)11-8-10-18(2)12-14-24(21-13-15-25-23(16-21)31-20(4)37-25)36-27(33)17-26(32)30(5,6)29(22)35/h7,12-13,15-16,19,22,24,26,28,32,34H,1,8-11,14,17H2,2-6H3/t19-,22+,24-,26-,28-/m0/s1 |
| InChIKey | VNHUIYWSVAQDTA-HTBNXNCASA-N |
| XLogP | 6.24 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|