C45H34FN5O3 — CID 68812213
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 68812213) has the molecular formula C45H34FN5O3 and a molecular weight of 711.80 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 68812213 |
| Molecular Formula | C45H34FN5O3 |
| Molecular Weight | 711.80 g/mol |
| Exact Mass | 711.26 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-fluoro-4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(-c2cnc3ccc(-c4cnn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4)cn23)cc1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C45H34FN5O3/c1-30(31-18-21-41-42(24-31)54-29-53-41)49-44(52)38-20-17-32(23-39(38)46)40-26-47-43-22-19-33(27-50(40)43)34-25-48-51(28-34)45(35-11-5-2-6-12-35,36-13-7-3-8-14-36)37-15-9-4-10-16-37/h2-28,30H,29H2,1H3,(H,49,52) |
| InChIKey | BKZRAPQAUCEZHM-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.80 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|