C15H17ClN2O — CID 68812455
2-(4-chlorophenyl)-5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-3-one (PubChem CID 68812455) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-3-one.
| Compound Name | 2-(4-chlorophenyl)-5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-3-one |
|---|---|
| PubChem CID | 68812455 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(4-chlorophenyl)-5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-3-one |
| SMILES | O=c1n(-c2ccc(Cl)cc2)cc2n1CCCCCC2 |
| InChI | InChI=1S/C15H17ClN2O/c16-12-6-8-13(9-7-12)18-11-14-5-3-1-2-4-10-17(14)15(18)19/h6-9,11H,1-5,10H2 |
| InChIKey | CSMUDBJVPMGUBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |