About N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide
N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide (PubChem CID 68812581) has the molecular formula C21H15F4N3O2S
and a molecular weight of 449.43 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide |
| PubChem CID | 68812581 |
| Molecular Formula | C21H15F4N3O2S |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H15F4N3O2S/c22-16-7-9-17(10-8-16)28-19-11-6-14(12-15(19)13-26-28)20(21(23,24)25)27-31(29,30)18-4-2-1-3-5-18/h1-13,20,27H |
| InChIKey | XZTFDSUWDJAADO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide?
The IUPAC name of N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide (CID 68812581) is N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide?
The canonical SMILES for N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide is O=S(=O)(NC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)(F)F)c1ccccc1.
What is the InChIKey of N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide?
The InChIKey is XZTFDSUWDJAADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F4N3O2S/c22-16-7-9-17(10-8-16)28-19-11-6-14(12-15(19)13-26-28)20(21(23,24)25)27-31(29,30)18-4-2-1-3-5-18/h1-13,20,27H.
What are the key properties of N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide?
N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide has a molecular weight of 449.43 g/mol, XLogP of 4.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide is sourced from PubChem (CID 68812581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).