C34H34N4O — CID 68813106
N-(3-aminopropyl)-N-[(1-benzyl-4-phenylimidazol-2-yl)-phenylmethyl]-4-methylbenzamide (PubChem CID 68813106) has the molecular formula C34H34N4O and a molecular weight of 514.67 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[(1-benzyl-4-phenylimidazol-2-yl)-phenylmethyl]-4-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-N-[(1-benzyl-4-phenylimidazol-2-yl)-phenylmethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 68813106 |
| Molecular Formula | C34H34N4O |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | N-(3-aminopropyl)-N-[(1-benzyl-4-phenylimidazol-2-yl)-phenylmethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCCN)C(c2ccccc2)c2nc(-c3ccccc3)cn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N4O/c1-26-18-20-30(21-19-26)34(39)38(23-11-22-35)32(29-16-9-4-10-17-29)33-36-31(28-14-7-3-8-15-28)25-37(33)24-27-12-5-2-6-13-27/h2-10,12-21,25,32H,11,22-24,35H2,1H3 |
| InChIKey | QVFVYOOEHCFLJO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |