C30H26F4N6O4 — CID 68813237
3-[[5-(1,3-benzodioxol-5-yl)-2-methyl-1,2,4-triazol-3-yl]-(5-ethyl-2-fluorophenyl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid (PubChem CID 68813237) has the molecular formula C30H26F4N6O4 and a molecular weight of 610.57 g/mol. Its IUPAC name is 3-[[5-(1,3-benzodioxol-5-yl)-2-methyl-1,2,4-triazol-3-yl]-(5-ethyl-2-fluorophenyl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[5-(1,3-benzodioxol-5-yl)-2-methyl-1,2,4-triazol-3-yl]-(5-ethyl-2-fluorophenyl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68813237 |
| Molecular Formula | C30H26F4N6O4 |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 3-[[5-(1,3-benzodioxol-5-yl)-2-methyl-1,2,4-triazol-3-yl]-(5-ethyl-2-fluorophenyl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(F)c(C(c2cc3cc(N)ccc3c(N)n2)c2nc(-c3ccc4c(c3)OCO4)nn2C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H25FN6O2.C2HF3O2/c1-3-15-4-8-21(29)20(10-15)25(22-12-17-11-18(30)6-7-19(17)26(31)32-22)28-33-27(34-35(28)2)16-5-9-23-24(13-16)37-14-36-23;3-2(4,5)1(6)7/h4-13,25H,3,14,30H2,1-2H3,(H2,31,32);(H,6,7) |
| InChIKey | CRGGZYYDBQEVIV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|