C27H25FN6 — CID 68813282
3-[(5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine (PubChem CID 68813282) has the molecular formula C27H25FN6 and a molecular weight of 452.54 g/mol. Its IUPAC name is 3-[(5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine.
| Compound Name | 3-[(5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine |
|---|---|
| PubChem CID | 68813282 |
| Molecular Formula | C27H25FN6 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[(5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine |
| SMILES | CCc1ccc(F)c(C(c2cc3cc(N)ccc3c(N)n2)c2nc(-c3ccccc3)nn2C)c1 |
| InChI | InChI=1S/C27H25FN6/c1-3-16-9-12-22(28)21(13-16)24(23-15-18-14-19(29)10-11-20(18)25(30)31-23)27-32-26(33-34(27)2)17-7-5-4-6-8-17/h4-15,24H,3,29H2,1-2H3,(H2,30,31) |
| InChIKey | WBZNLRDMDQIOSW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|