C33H34FN5O2 — CID 68813467
3-[(3-cyclohexyloxy-5-ethoxy-2-fluorophenyl)-(5-phenyl-1H-imidazol-2-yl)methyl]isoquinoline-1,6-diamine (PubChem CID 68813467) has the molecular formula C33H34FN5O2 and a molecular weight of 551.67 g/mol. Its IUPAC name is 3-[(3-cyclohexyloxy-5-ethoxy-2-fluorophenyl)-(5-phenyl-1H-imidazol-2-yl)methyl]isoquinoline-1,6-diamine.
| Compound Name | 3-[(3-cyclohexyloxy-5-ethoxy-2-fluorophenyl)-(5-phenyl-1H-imidazol-2-yl)methyl]isoquinoline-1,6-diamine |
|---|---|
| PubChem CID | 68813467 |
| Molecular Formula | C33H34FN5O2 |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 3-[(3-cyclohexyloxy-5-ethoxy-2-fluorophenyl)-(5-phenyl-1H-imidazol-2-yl)methyl]isoquinoline-1,6-diamine |
| SMILES | CCOc1cc(OC2CCCCC2)c(F)c(C(c2cc3cc(N)ccc3c(N)n2)c2ncc(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C33H34FN5O2/c1-2-40-24-17-26(31(34)29(18-24)41-23-11-7-4-8-12-23)30(33-37-19-28(39-33)20-9-5-3-6-10-20)27-16-21-15-22(35)13-14-25(21)32(36)38-27/h3,5-6,9-10,13-19,23,30H,2,4,7-8,11-12,35H2,1H3,(H2,36,38)(H,37,39) |
| InChIKey | ZVBPUSLRZSLDHT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|