C18H28ClN3 — CID 68813544
4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]cyclohexan-1-amine (PubChem CID 68813544) has the molecular formula C18H28ClN3 and a molecular weight of 321.90 g/mol. Its IUPAC name is 4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 68813544 |
| Molecular Formula | C18H28ClN3 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]cyclohexan-1-amine |
| SMILES | NC1CCC(CCN2CCN(c3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H28ClN3/c19-16-3-7-18(8-4-16)22-13-11-21(12-14-22)10-9-15-1-5-17(20)6-2-15/h3-4,7-8,15,17H,1-2,5-6,9-14,20H2 |
| InChIKey | CPDKALXOFWZEJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |