About tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate
tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate (PubChem CID 68813915) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 68813915 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1cc(-c2nccs2)no1 |
| InChI | InChI=1S/C15H19N3O3S/c1-15(2,3)20-14(19)18-7-4-5-11(18)12-9-10(17-21-12)13-16-6-8-22-13/h6,8-9,11H,4-5,7H2,1-3H3/t11-/m0/s1 |
| InChIKey | VSPYKCDWQSIFGW-NSHDSACASA-N |
| XLogP | 3.87 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate (CID 68813915) is tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1c1cc(-c2nccs2)no1.
What is the InChIKey of tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate?
The InChIKey is VSPYKCDWQSIFGW-NSHDSACASA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-15(2,3)20-14(19)18-7-4-5-11(18)12-9-10(17-21-12)13-16-6-8-22-13/h6,8-9,11H,4-5,7H2,1-3H3/t11-/m0/s1.
What are the key properties of tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate has a molecular weight of 321.40 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[3-(1,3-thiazol-2-yl)-1,2-oxazol-5-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 68813915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).