C23H27F2IN4O4 — CID 68814209
[3-[(1S)-1-[[(1R,2S)-1,2-dihydroxycyclopentyl]amino]propyl]-3-hydroxyazetidin-1-yl]-[2-fluoro-3-(2-fluoro-4-iodoanilino)-4-pyridinyl]methanone (PubChem CID 68814209) has the molecular formula C23H27F2IN4O4 and a molecular weight of 588.39 g/mol. Its IUPAC name is [3-[(1S)-1-[[(1R,2S)-1,2-dihydroxycyclopentyl]amino]propyl]-3-hydroxyazetidin-1-yl]-[2-fluoro-3-(2-fluoro-4-iodoanilino)-4-pyridinyl]methanone.
| Compound Name | [3-[(1S)-1-[[(1R,2S)-1,2-dihydroxycyclopentyl]amino]propyl]-3-hydroxyazetidin-1-yl]-[2-fluoro-3-(2-fluoro-4-iodoanilino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 68814209 |
| Molecular Formula | C23H27F2IN4O4 |
| Molecular Weight | 588.39 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | [3-[(1S)-1-[[(1R,2S)-1,2-dihydroxycyclopentyl]amino]propyl]-3-hydroxyazetidin-1-yl]-[2-fluoro-3-(2-fluoro-4-iodoanilino)-4-pyridinyl]methanone |
| SMILES | CC[C@H](N[C@@]1(O)CCC[C@@H]1O)C1(O)CN(C(=O)c2ccnc(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C23H27F2IN4O4/c1-2-17(29-23(34)8-3-4-18(23)31)22(33)11-30(12-22)21(32)14-7-9-27-20(25)19(14)28-16-6-5-13(26)10-15(16)24/h5-7,9-10,17-18,28-29,31,33-34H,2-4,8,11-12H2,1H3/t17-,18-,23+/m0/s1 |
| InChIKey | ATSYSWQAZTYIJH-IUKKYPGJSA-N |
| XLogP | 2.50 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|